C14H16N2O — CID 106651230
cyclohexen-1-yl(imidazo[1,2-a]pyridin-2-yl)methanol (PubChem CID 106651230) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is cyclohexen-1-yl(imidazo[1,2-a]pyridin-2-yl)methanol.
| Compound Name | cyclohexen-1-yl(imidazo[1,2-a]pyridin-2-yl)methanol |
|---|---|
| PubChem CID | 106651230 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | cyclohexen-1-yl(imidazo[1,2-a]pyridin-2-yl)methanol |
| SMILES | OC(C1=CCCCC1)c1cn2ccccc2n1 |
| InChI | InChI=1S/C14H16N2O/c17-14(11-6-2-1-3-7-11)12-10-16-9-5-4-8-13(16)15-12/h4-6,8-10,14,17H,1-3,7H2 |
| InChIKey | UAVWSDVMFBQBMX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|