C15H22ClFO — CID 103053392
1-(5-chloro-2-fluorophenyl)-4,5,5-trimethylhexan-2-ol (PubChem CID 103053392) has the molecular formula C15H22ClFO and a molecular weight of 272.79 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)-4,5,5-trimethylhexan-2-ol.
| Compound Name | 1-(5-chloro-2-fluorophenyl)-4,5,5-trimethylhexan-2-ol |
|---|---|
| PubChem CID | 103053392 |
| Molecular Formula | C15H22ClFO |
| Molecular Weight | 272.79 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)-4,5,5-trimethylhexan-2-ol |
| SMILES | CC(CC(O)Cc1cc(Cl)ccc1F)C(C)(C)C |
| InChI | InChI=1S/C15H22ClFO/c1-10(15(2,3)4)7-13(18)9-11-8-12(16)5-6-14(11)17/h5-6,8,10,13,18H,7,9H2,1-4H3 |
| InChIKey | DOPPMYZVWQBJQW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |