C13H17N5O2 — CID 103057470
5-ethyl-1-[[5-(ethylamino)pyrazin-2-yl]methyl]pyrimidine-2,4-dione (PubChem CID 103057470) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-ethyl-1-[[5-(ethylamino)pyrazin-2-yl]methyl]pyrimidine-2,4-dione.
| Compound Name | 5-ethyl-1-[[5-(ethylamino)pyrazin-2-yl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 103057470 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 5-ethyl-1-[[5-(ethylamino)pyrazin-2-yl]methyl]pyrimidine-2,4-dione |
| SMILES | CCNc1cnc(Cn2cc(CC)c(=O)[nH]c2=O)cn1 |
| InChI | InChI=1S/C13H17N5O2/c1-3-9-7-18(13(20)17-12(9)19)8-10-5-16-11(6-15-10)14-4-2/h5-7H,3-4,8H2,1-2H3,(H,14,16)(H,17,19,20) |
| InChIKey | UEXCFCYYVFEPES-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |