C7H11Cl2NS — CID 103062967
N-[(E)-2,3-dichloroprop-2-enyl]thiolan-3-amine (PubChem CID 103062967) has the molecular formula C7H11Cl2NS and a molecular weight of 212.14 g/mol. Its IUPAC name is N-[(E)-2,3-dichloroprop-2-enyl]thiolan-3-amine.
| Compound Name | N-[(E)-2,3-dichloroprop-2-enyl]thiolan-3-amine |
|---|---|
| PubChem CID | 103062967 |
| Molecular Formula | C7H11Cl2NS |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | N-[(E)-2,3-dichloroprop-2-enyl]thiolan-3-amine |
| SMILES | Cl/C=C(/Cl)CNC1CCSC1 |
| InChI | InChI=1S/C7H11Cl2NS/c8-3-6(9)4-10-7-1-2-11-5-7/h3,7,10H,1-2,4-5H2/b6-3+ |
| InChIKey | FYBPFWKHECXUCO-ZZXKWVIFSA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |