C9H17Cl2NS — CID 104874897
N-(2,3-dichloroprop-2-enyl)-4-ethylsulfanylbutan-2-amine (PubChem CID 104874897) has the molecular formula C9H17Cl2NS and a molecular weight of 242.21 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)-4-ethylsulfanylbutan-2-amine.
| Compound Name | N-(2,3-dichloroprop-2-enyl)-4-ethylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 104874897 |
| Molecular Formula | C9H17Cl2NS |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)-4-ethylsulfanylbutan-2-amine |
| SMILES | CCSCCC(C)NCC(Cl)=CCl |
| InChI | InChI=1S/C9H17Cl2NS/c1-3-13-5-4-8(2)12-7-9(11)6-10/h6,8,12H,3-5,7H2,1-2H3 |
| InChIKey | UTIWJVFEUCRLCF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|