C11H20N2OS — CID 103065491
5-ethyl-2,5-dimethyl-3-(thiolan-3-yl)imidazolidin-4-one (PubChem CID 103065491) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 5-ethyl-2,5-dimethyl-3-(thiolan-3-yl)imidazolidin-4-one.
| Compound Name | 5-ethyl-2,5-dimethyl-3-(thiolan-3-yl)imidazolidin-4-one |
|---|---|
| PubChem CID | 103065491 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 5-ethyl-2,5-dimethyl-3-(thiolan-3-yl)imidazolidin-4-one |
| SMILES | CCC1(C)NC(C)N(C2CCSC2)C1=O |
| InChI | InChI=1S/C11H20N2OS/c1-4-11(3)10(14)13(8(2)12-11)9-5-6-15-7-9/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | PYJMEHYFSGCOJA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |