C14H14ClNO2 — CID 103065742
1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione (PubChem CID 103065742) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione.
| Compound Name | 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione |
|---|---|
| PubChem CID | 103065742 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione |
| SMILES | C=C(CCl)CN1C(=O)C(=O)c2c(C)cc(C)cc21 |
| InChI | InChI=1S/C14H14ClNO2/c1-8-4-10(3)12-11(5-8)16(7-9(2)6-15)14(18)13(12)17/h4-5H,2,6-7H2,1,3H3 |
| InChIKey | NMFYSEVQRIASBT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|