About 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione
1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione (PubChem CID 103065742) has the molecular formula C14H14ClNO2
and a molecular weight of 263.72 g/mol. Its IUPAC name is 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione.
Molecular Properties
| Compound Name | 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione |
| PubChem CID | 103065742 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione |
| SMILES | C=C(CCl)CN1C(=O)C(=O)c2c(C)cc(C)cc21 |
| InChI | InChI=1S/C14H14ClNO2/c1-8-4-10(3)12-11(5-8)16(7-9(2)6-15)14(18)13(12)17/h4-5H,2,6-7H2,1,3H3 |
| InChIKey | NMFYSEVQRIASBT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione?
The IUPAC name of 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione (CID 103065742) is 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione.
What is the SMILES notation for 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione?
The canonical SMILES for 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione is C=C(CCl)CN1C(=O)C(=O)c2c(C)cc(C)cc21.
What is the InChIKey of 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione?
The InChIKey is NMFYSEVQRIASBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNO2/c1-8-4-10(3)12-11(5-8)16(7-9(2)6-15)14(18)13(12)17/h4-5H,2,6-7H2,1,3H3.
What are the key properties of 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione?
1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione has a molecular weight of 263.72 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(chloromethyl)prop-2-enyl]-4,6-dimethylindole-2,3-dione is sourced from PubChem (CID 103065742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).