C14H16N2O4 — CID 61355287
2-(4,6-dimethyl-2,3-dioxoindol-1-yl)-N-(2-hydroxyethyl)acetamide (PubChem CID 61355287) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2,3-dioxoindol-1-yl)-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-(4,6-dimethyl-2,3-dioxoindol-1-yl)-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 61355287 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-(4,6-dimethyl-2,3-dioxoindol-1-yl)-N-(2-hydroxyethyl)acetamide |
| SMILES | Cc1cc(C)c2c(c1)N(CC(=O)NCCO)C(=O)C2=O |
| InChI | InChI=1S/C14H16N2O4/c1-8-5-9(2)12-10(6-8)16(14(20)13(12)19)7-11(18)15-3-4-17/h5-6,17H,3-4,7H2,1-2H3,(H,15,18) |
| InChIKey | FFSDXYGWEBIPAH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|