C10H11F2NO — CID 103067211
2-[(3,5-difluorophenoxy)methyl]prop-2-en-1-amine (PubChem CID 103067211) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 2-[(3,5-difluorophenoxy)methyl]prop-2-en-1-amine.
| Compound Name | 2-[(3,5-difluorophenoxy)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103067211 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-[(3,5-difluorophenoxy)methyl]prop-2-en-1-amine |
| SMILES | C=C(CN)COc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H11F2NO/c1-7(5-13)6-14-10-3-8(11)2-9(12)4-10/h2-4H,1,5-6,13H2 |
| InChIKey | CSKUQDGYHLKZKS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|