C8H10ClF2NO — CID 66980622
2-(3,5-difluorophenoxy)ethanamine;hydrochloride (PubChem CID 66980622) has the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. Its IUPAC name is 2-(3,5-difluorophenoxy)ethanamine;hydrochloride.
| Compound Name | 2-(3,5-difluorophenoxy)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 66980622 |
| Molecular Formula | C8H10ClF2NO |
| Molecular Weight | 209.62 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 2-(3,5-difluorophenoxy)ethanamine;hydrochloride |
| SMILES | Cl.NCCOc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H9F2NO.ClH/c9-6-3-7(10)5-8(4-6)12-2-1-11;/h3-5H,1-2,11H2;1H |
| InChIKey | UXFBRXQUBAAQJO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.62 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |