C11H16N2O3 — CID 89220527
3,5-bis(2-aminoethoxy)benzaldehyde (PubChem CID 89220527) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3,5-bis(2-aminoethoxy)benzaldehyde.
| Compound Name | 3,5-bis(2-aminoethoxy)benzaldehyde |
|---|---|
| PubChem CID | 89220527 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3,5-bis(2-aminoethoxy)benzaldehyde |
| SMILES | NCCOc1cc(C=O)cc(OCCN)c1 |
| InChI | InChI=1S/C11H16N2O3/c12-1-3-15-10-5-9(8-14)6-11(7-10)16-4-2-13/h5-8H,1-4,12-13H2 |
| InChIKey | WWBUPUNKOBISII-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|