C10H11ClF2O — CID 62785225
1-(4-chlorobutoxy)-3,5-difluorobenzene (PubChem CID 62785225) has the molecular formula C10H11ClF2O and a molecular weight of 220.65 g/mol. Its IUPAC name is 1-(4-chlorobutoxy)-3,5-difluorobenzene.
| Compound Name | 1-(4-chlorobutoxy)-3,5-difluorobenzene |
|---|---|
| PubChem CID | 62785225 |
| Molecular Formula | C10H11ClF2O |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 1-(4-chlorobutoxy)-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(OCCCCCl)c1 |
| InChI | InChI=1S/C10H11ClF2O/c11-3-1-2-4-14-10-6-8(12)5-9(13)7-10/h5-7H,1-4H2 |
| InChIKey | LADUHWYOCBUXGY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|