C10H12ClF2NO3 — CID 69214837
methyl 4-(2-aminoethoxy)-2,6-difluorobenzoate;hydrochloride (PubChem CID 69214837) has the molecular formula C10H12ClF2NO3 and a molecular weight of 267.66 g/mol. Its IUPAC name is methyl 4-(2-aminoethoxy)-2,6-difluorobenzoate;hydrochloride.
| Compound Name | methyl 4-(2-aminoethoxy)-2,6-difluorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 69214837 |
| Molecular Formula | C10H12ClF2NO3 |
| Molecular Weight | 267.66 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | methyl 4-(2-aminoethoxy)-2,6-difluorobenzoate;hydrochloride |
| SMILES | COC(=O)c1c(F)cc(OCCN)cc1F.Cl |
| InChI | InChI=1S/C10H11F2NO3.ClH/c1-15-10(14)9-7(11)4-6(5-8(9)12)16-3-2-13;/h4-5H,2-3,13H2,1H3;1H |
| InChIKey | PBBWGDVFGDOBPW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.66 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |