C12H15F2NO2 — CID 149430518
N-ethyl-2,6-difluoro-4-propoxybenzamide (PubChem CID 149430518) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is N-ethyl-2,6-difluoro-4-propoxybenzamide.
| Compound Name | N-ethyl-2,6-difluoro-4-propoxybenzamide |
|---|---|
| PubChem CID | 149430518 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-ethyl-2,6-difluoro-4-propoxybenzamide |
| SMILES | CCCOc1cc(F)c(C(=O)NCC)c(F)c1 |
| InChI | InChI=1S/C12H15F2NO2/c1-3-5-17-8-6-9(13)11(10(14)7-8)12(16)15-4-2/h6-7H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | YUYPALCURDVRTB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |