C23H38FNO2 — CID 143388228
4-(6,8-dimethyl-4-propylnonoxy)-N-ethyl-2-fluorobenzamide (PubChem CID 143388228) has the molecular formula C23H38FNO2 and a molecular weight of 379.56 g/mol. Its IUPAC name is 4-(6,8-dimethyl-4-propylnonoxy)-N-ethyl-2-fluorobenzamide.
| Compound Name | 4-(6,8-dimethyl-4-propylnonoxy)-N-ethyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 143388228 |
| Molecular Formula | C23H38FNO2 |
| Molecular Weight | 379.56 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | 4-(6,8-dimethyl-4-propylnonoxy)-N-ethyl-2-fluorobenzamide |
| SMILES | CCCC(CCCOc1ccc(C(=O)NCC)c(F)c1)CC(C)CC(C)C |
| InChI | InChI=1S/C23H38FNO2/c1-6-9-19(15-18(5)14-17(3)4)10-8-13-27-20-11-12-21(22(24)16-20)23(26)25-7-2/h11-12,16-19H,6-10,13-15H2,1-5H3,(H,25,26) |
| InChIKey | VUVVKQBGSFQPCY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|