C11H10F4O2 — CID 91657905
2,2,2-trifluoro-1-(3-fluoro-5-propoxyphenyl)ethanone (PubChem CID 91657905) has the molecular formula C11H10F4O2 and a molecular weight of 250.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(3-fluoro-5-propoxyphenyl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(3-fluoro-5-propoxyphenyl)ethanone |
|---|---|
| PubChem CID | 91657905 |
| Molecular Formula | C11H10F4O2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2,2,2-trifluoro-1-(3-fluoro-5-propoxyphenyl)ethanone |
| SMILES | CCCOc1cc(F)cc(C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F4O2/c1-2-3-17-9-5-7(4-8(12)6-9)10(16)11(13,14)15/h4-6H,2-3H2,1H3 |
| InChIKey | FOJACQYVMKKZPH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |