C13H15F5O2 — CID 172798464
3,3,4,4-tetrafluoro-1-(3-fluoro-5-propoxyphenyl)butan-1-ol (PubChem CID 172798464) has the molecular formula C13H15F5O2 and a molecular weight of 298.25 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1-(3-fluoro-5-propoxyphenyl)butan-1-ol.
| Compound Name | 3,3,4,4-tetrafluoro-1-(3-fluoro-5-propoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 172798464 |
| Molecular Formula | C13H15F5O2 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1-(3-fluoro-5-propoxyphenyl)butan-1-ol |
| SMILES | CCCOc1cc(F)cc(C(O)CC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C13H15F5O2/c1-2-3-20-10-5-8(4-9(14)6-10)11(19)7-13(17,18)12(15)16/h4-6,11-12,19H,2-3,7H2,1H3 |
| InChIKey | QNIMHUJDWKCZJX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|