C14H25N5S — CID 103068279
N-tert-butyl-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]prop-2-en-1-amine (PubChem CID 103068279) has the molecular formula C14H25N5S and a molecular weight of 295.46 g/mol. Its IUPAC name is N-tert-butyl-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]prop-2-en-1-amine.
| Compound Name | N-tert-butyl-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103068279 |
| Molecular Formula | C14H25N5S |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-tert-butyl-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]prop-2-en-1-amine |
| SMILES | C=C(CNC(C)(C)C)CSc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C14H25N5S/c1-11(9-15-14(2,3)4)10-20-13-16-17-18-19(13)12-7-5-6-8-12/h12,15H,1,5-10H2,2-4H3 |
| InChIKey | NGVWCLJVPASFSS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|