C15H21N5S — CID 103068309
N-tert-butyl-2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]prop-2-en-1-amine (PubChem CID 103068309) has the molecular formula C15H21N5S and a molecular weight of 303.43 g/mol. Its IUPAC name is N-tert-butyl-2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]prop-2-en-1-amine.
| Compound Name | N-tert-butyl-2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103068309 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-tert-butyl-2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]prop-2-en-1-amine |
| SMILES | C=C(CNC(C)(C)C)CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C15H21N5S/c1-12(10-16-15(2,3)4)11-21-14-17-18-19-20(14)13-8-6-5-7-9-13/h5-9,16H,1,10-11H2,2-4H3 |
| InChIKey | WZSMFDCNJDBJAD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|