C12H22F3N3 — CID 103070423
N-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-en-1-amine (PubChem CID 103070423) has the molecular formula C12H22F3N3 and a molecular weight of 265.32 g/mol. Its IUPAC name is N-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-en-1-amine.
| Compound Name | N-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103070423 |
| Molecular Formula | C12H22F3N3 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-ethyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-en-1-amine |
| SMILES | C=C(CNCC)CN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3N3/c1-3-16-8-11(2)9-17-4-6-18(7-5-17)10-12(13,14)15/h16H,2-10H2,1H3 |
| InChIKey | FPQJVLMLDINAAI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|