C8H11F5N2 — CID 163511269
1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]piperazine (PubChem CID 163511269) has the molecular formula C8H11F5N2 and a molecular weight of 230.18 g/mol. Its IUPAC name is 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]piperazine.
| Compound Name | 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]piperazine |
|---|---|
| PubChem CID | 163511269 |
| Molecular Formula | C8H11F5N2 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]piperazine |
| SMILES | C=C(C(F)(F)F)C(F)(F)N1CCNCC1 |
| InChI | InChI=1S/C8H11F5N2/c1-6(7(9,10)11)8(12,13)15-4-2-14-3-5-15/h14H,1-5H2 |
| InChIKey | DCXACHDSPGUYDU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|