C14H26F3N3 — CID 103070425
N-tert-butyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-en-1-amine (PubChem CID 103070425) has the molecular formula C14H26F3N3 and a molecular weight of 293.38 g/mol. Its IUPAC name is N-tert-butyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-en-1-amine.
| Compound Name | N-tert-butyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103070425 |
| Molecular Formula | C14H26F3N3 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-tert-butyl-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-en-1-amine |
| SMILES | C=C(CNC(C)(C)C)CN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H26F3N3/c1-12(9-18-13(2,3)4)10-19-5-7-20(8-6-19)11-14(15,16)17/h18H,1,5-11H2,2-4H3 |
| InChIKey | JPYACNNWHSFUQN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|