C8H14N4 — CID 103071547
N-ethyl-2-(1,2,4-triazol-1-ylmethyl)prop-2-en-1-amine (PubChem CID 103071547) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is N-ethyl-2-(1,2,4-triazol-1-ylmethyl)prop-2-en-1-amine.
| Compound Name | N-ethyl-2-(1,2,4-triazol-1-ylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103071547 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N-ethyl-2-(1,2,4-triazol-1-ylmethyl)prop-2-en-1-amine |
| SMILES | C=C(CNCC)Cn1cncn1 |
| InChI | InChI=1S/C8H14N4/c1-3-9-4-8(2)5-12-7-10-6-11-12/h6-7,9H,2-5H2,1H3 |
| InChIKey | WTQNKHQAHIVOOH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|