C10H18N2O2 — CID 103071851
3-[2-(propylaminomethyl)prop-2-enyl]-1,3-oxazolidin-2-one (PubChem CID 103071851) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-[2-(propylaminomethyl)prop-2-enyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(propylaminomethyl)prop-2-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 103071851 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-[2-(propylaminomethyl)prop-2-enyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(CNCCC)CN1CCOC1=O |
| InChI | InChI=1S/C10H18N2O2/c1-3-4-11-7-9(2)8-12-5-6-14-10(12)13/h11H,2-8H2,1H3 |
| InChIKey | DOGCXMLGAIEJIZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|