C10H18N4 — CID 103072093
2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-N-ethylprop-2-en-1-amine (PubChem CID 103072093) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-N-ethylprop-2-en-1-amine.
| Compound Name | 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-N-ethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103072093 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-N-ethylprop-2-en-1-amine |
| SMILES | C=C(CNCC)Cn1nc(C)nc1C |
| InChI | InChI=1S/C10H18N4/c1-5-11-6-8(2)7-14-10(4)12-9(3)13-14/h11H,2,5-7H2,1,3-4H3 |
| InChIKey | IOWUXSMGUIWKBY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|