C13H23N3 — CID 103072227
N-tert-butyl-2-[(2-ethylimidazol-1-yl)methyl]prop-2-en-1-amine (PubChem CID 103072227) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N-tert-butyl-2-[(2-ethylimidazol-1-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-tert-butyl-2-[(2-ethylimidazol-1-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103072227 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N-tert-butyl-2-[(2-ethylimidazol-1-yl)methyl]prop-2-en-1-amine |
| SMILES | C=C(CNC(C)(C)C)Cn1ccnc1CC |
| InChI | InChI=1S/C13H23N3/c1-6-12-14-7-8-16(12)10-11(2)9-15-13(3,4)5/h7-8,15H,2,6,9-10H2,1,3-5H3 |
| InChIKey | ORHSIUUQXOUANB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|