C13H18N2 — CID 143625447
1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-ethylimidazole (PubChem CID 143625447) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-ethylimidazole.
| Compound Name | 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-ethylimidazole |
|---|---|
| PubChem CID | 143625447 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2-ethylimidazole |
| SMILES | C=C/C(=C\C=C/C)Cn1ccnc1CC |
| InChI | InChI=1S/C13H18N2/c1-4-7-8-12(5-2)11-15-10-9-14-13(15)6-3/h4-5,7-10H,2,6,11H2,1,3H3/b7-4-,12-8+ |
| InChIKey | BJZURXHMAXNTDY-OTIJGBKASA-N |
| XLogP | 3.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|