C12H18N4O3 — CID 103073017
1-[2-[(tert-butylamino)methyl]prop-2-enyl]-5-nitropyrimidin-2-one (PubChem CID 103073017) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-[2-[(tert-butylamino)methyl]prop-2-enyl]-5-nitropyrimidin-2-one.
| Compound Name | 1-[2-[(tert-butylamino)methyl]prop-2-enyl]-5-nitropyrimidin-2-one |
|---|---|
| PubChem CID | 103073017 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-[2-[(tert-butylamino)methyl]prop-2-enyl]-5-nitropyrimidin-2-one |
| SMILES | C=C(CNC(C)(C)C)Cn1cc([N+](=O)[O-])cnc1=O |
| InChI | InChI=1S/C12H18N4O3/c1-9(5-14-12(2,3)4)7-15-8-10(16(18)19)6-13-11(15)17/h6,8,14H,1,5,7H2,2-4H3 |
| InChIKey | RMIBCTZNTJCOJX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|