C14H19NS — CID 103073178
2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]prop-2-ene-1-thiol (PubChem CID 103073178) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073178 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN1CC(C)Cc2ccccc21 |
| InChI | InChI=1S/C14H19NS/c1-11-7-13-5-3-4-6-14(13)15(8-11)9-12(2)10-16/h3-6,11,16H,2,7-10H2,1H3 |
| InChIKey | SDNGQNKIRZFNPN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|