C12H26N2S — CID 103073354
2-[[2-(dimethylamino)ethyl-(2-methylpropyl)amino]methyl]prop-2-ene-1-thiol (PubChem CID 103073354) has the molecular formula C12H26N2S and a molecular weight of 230.42 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)ethyl-(2-methylpropyl)amino]methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[[2-(dimethylamino)ethyl-(2-methylpropyl)amino]methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073354 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-[[2-(dimethylamino)ethyl-(2-methylpropyl)amino]methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN(CCN(C)C)CC(C)C |
| InChI | InChI=1S/C12H26N2S/c1-11(2)8-14(7-6-13(4)5)9-12(3)10-15/h11,15H,3,6-10H2,1-2,4-5H3 |
| InChIKey | KHRRZJMWPBFPAU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|