C7H13F2NS — CID 103073550
2-[[2,2-difluoroethyl(methyl)amino]methyl]prop-2-ene-1-thiol (PubChem CID 103073550) has the molecular formula C7H13F2NS and a molecular weight of 181.25 g/mol. Its IUPAC name is 2-[[2,2-difluoroethyl(methyl)amino]methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[[2,2-difluoroethyl(methyl)amino]methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073550 |
| Molecular Formula | C7H13F2NS |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-[[2,2-difluoroethyl(methyl)amino]methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN(C)CC(F)F |
| InChI | InChI=1S/C7H13F2NS/c1-6(5-11)3-10(2)4-7(8)9/h7,11H,1,3-5H2,2H3 |
| InChIKey | QCHHZPLVVIYCDT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|