C11H21NO2 — CID 103075084
2-[(2,6-dimethyloxan-4-yl)oxymethyl]prop-2-en-1-amine (PubChem CID 103075084) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-[(2,6-dimethyloxan-4-yl)oxymethyl]prop-2-en-1-amine.
| Compound Name | 2-[(2,6-dimethyloxan-4-yl)oxymethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103075084 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-[(2,6-dimethyloxan-4-yl)oxymethyl]prop-2-en-1-amine |
| SMILES | C=C(CN)COC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H21NO2/c1-8(6-12)7-13-11-4-9(2)14-10(3)5-11/h9-11H,1,4-7,12H2,2-3H3 |
| InChIKey | LTKKZXGCMAYJLD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|