C12H15FN4O — CID 103078820
3-N-(4-ethoxy-3-fluorophenyl)-1-methylpyrazole-3,4-diamine (PubChem CID 103078820) has the molecular formula C12H15FN4O and a molecular weight of 250.28 g/mol. Its IUPAC name is 3-N-(4-ethoxy-3-fluorophenyl)-1-methylpyrazole-3,4-diamine.
| Compound Name | 3-N-(4-ethoxy-3-fluorophenyl)-1-methylpyrazole-3,4-diamine |
|---|---|
| PubChem CID | 103078820 |
| Molecular Formula | C12H15FN4O |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-N-(4-ethoxy-3-fluorophenyl)-1-methylpyrazole-3,4-diamine |
| SMILES | CCOc1ccc(Nc2nn(C)cc2N)cc1F |
| InChI | InChI=1S/C12H15FN4O/c1-3-18-11-5-4-8(6-9(11)13)15-12-10(14)7-17(2)16-12/h4-7H,3,14H2,1-2H3,(H,15,16) |
| InChIKey | MPPQQJXTEOHELI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |