C14H26F2N2O — CID 103082726
N-[2-(2,2-difluoroethoxy)ethyl]-1-(3-methylbut-2-enyl)piperidin-4-amine (PubChem CID 103082726) has the molecular formula C14H26F2N2O and a molecular weight of 276.37 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-1-(3-methylbut-2-enyl)piperidin-4-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-1-(3-methylbut-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 103082726 |
| Molecular Formula | C14H26F2N2O |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-1-(3-methylbut-2-enyl)piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(NCCOCC(F)F)CC1 |
| InChI | InChI=1S/C14H26F2N2O/c1-12(2)3-7-18-8-4-13(5-9-18)17-6-10-19-11-14(15)16/h3,13-14,17H,4-11H2,1-2H3 |
| InChIKey | LNXPDTKBACILOW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|