C10H13ClN4S — CID 103084567
5-(1-chloroethyl)-1-[(4,5-dimethylthiophen-2-yl)methyl]tetrazole (PubChem CID 103084567) has the molecular formula C10H13ClN4S and a molecular weight of 256.76 g/mol. Its IUPAC name is 5-(1-chloroethyl)-1-[(4,5-dimethylthiophen-2-yl)methyl]tetrazole.
| Compound Name | 5-(1-chloroethyl)-1-[(4,5-dimethylthiophen-2-yl)methyl]tetrazole |
|---|---|
| PubChem CID | 103084567 |
| Molecular Formula | C10H13ClN4S |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5-(1-chloroethyl)-1-[(4,5-dimethylthiophen-2-yl)methyl]tetrazole |
| SMILES | Cc1cc(Cn2nnnc2C(C)Cl)sc1C |
| InChI | InChI=1S/C10H13ClN4S/c1-6-4-9(16-8(6)3)5-15-10(7(2)11)12-13-14-15/h4,7H,5H2,1-3H3 |
| InChIKey | WECXGEFKIKVOID-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|