C8H13ClN4S2 — CID 103084677
5-(1-chloroethyl)-1-(1,4-dithian-2-ylmethyl)tetrazole (PubChem CID 103084677) has the molecular formula C8H13ClN4S2 and a molecular weight of 264.81 g/mol. Its IUPAC name is 5-(1-chloroethyl)-1-(1,4-dithian-2-ylmethyl)tetrazole.
| Compound Name | 5-(1-chloroethyl)-1-(1,4-dithian-2-ylmethyl)tetrazole |
|---|---|
| PubChem CID | 103084677 |
| Molecular Formula | C8H13ClN4S2 |
| Molecular Weight | 264.81 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 5-(1-chloroethyl)-1-(1,4-dithian-2-ylmethyl)tetrazole |
| SMILES | CC(Cl)c1nnnn1CC1CSCCS1 |
| InChI | InChI=1S/C8H13ClN4S2/c1-6(9)8-10-11-12-13(8)4-7-5-14-2-3-15-7/h6-7H,2-5H2,1H3 |
| InChIKey | OLQFOWRSGYGCQE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.81 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|