C18H19NO2S — CID 10308529
(2E)-2-(6,6-dimethyl-5,7-dihydrothieno[3,2-c]pyridin-4-ylidene)-1-(2-methoxyphenyl)ethanone (PubChem CID 10308529) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is (2E)-2-(6,6-dimethyl-5,7-dihydrothieno[3,2-c]pyridin-4-ylidene)-1-(2-methoxyphenyl)ethanone.
| Compound Name | (2E)-2-(6,6-dimethyl-5,7-dihydrothieno[3,2-c]pyridin-4-ylidene)-1-(2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 10308529 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (2E)-2-(6,6-dimethyl-5,7-dihydrothieno[3,2-c]pyridin-4-ylidene)-1-(2-methoxyphenyl)ethanone |
| SMILES | COc1ccccc1C(=O)/C=C1/NC(C)(C)Cc2sccc21 |
| InChI | InChI=1S/C18H19NO2S/c1-18(2)11-17-12(8-9-22-17)14(19-18)10-15(20)13-6-4-5-7-16(13)21-3/h4-10,19H,11H2,1-3H3/b14-10+ |
| InChIKey | IIVKTZMOCBCRAR-GXDHUFHOSA-N |
| XLogP | 3.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|