C11H23NO — CID 103093411
N-ethyl-6-methoxy-3,5-dimethylhex-3-en-2-amine (PubChem CID 103093411) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is N-ethyl-6-methoxy-3,5-dimethylhex-3-en-2-amine.
| Compound Name | N-ethyl-6-methoxy-3,5-dimethylhex-3-en-2-amine |
|---|---|
| PubChem CID | 103093411 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | N-ethyl-6-methoxy-3,5-dimethylhex-3-en-2-amine |
| SMILES | CCNC(C)C(C)=CC(C)COC |
| InChI | InChI=1S/C11H23NO/c1-6-12-11(4)10(3)7-9(2)8-13-5/h7,9,11-12H,6,8H2,1-5H3 |
| InChIKey | IKLNZQSKMIFZJU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|