C10H21NO — CID 104881853
N-ethyl-5-methoxy-2,4-dimethylpent-2-en-1-amine (PubChem CID 104881853) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is N-ethyl-5-methoxy-2,4-dimethylpent-2-en-1-amine.
| Compound Name | N-ethyl-5-methoxy-2,4-dimethylpent-2-en-1-amine |
|---|---|
| PubChem CID | 104881853 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | N-ethyl-5-methoxy-2,4-dimethylpent-2-en-1-amine |
| SMILES | CCNCC(C)=CC(C)COC |
| InChI | InChI=1S/C10H21NO/c1-5-11-7-9(2)6-10(3)8-12-4/h6,10-11H,5,7-8H2,1-4H3 |
| InChIKey | GDEXZSDPRWZHMT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|