C11H19N — CID 138461694
(Z)-N-ethyl-2,5-dimethylhept-2-en-6-yn-1-amine (PubChem CID 138461694) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (Z)-N-ethyl-2,5-dimethylhept-2-en-6-yn-1-amine.
| Compound Name | (Z)-N-ethyl-2,5-dimethylhept-2-en-6-yn-1-amine |
|---|---|
| PubChem CID | 138461694 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (Z)-N-ethyl-2,5-dimethylhept-2-en-6-yn-1-amine |
| SMILES | C#CC(C)C/C=C(/C)CNCC |
| InChI | InChI=1S/C11H19N/c1-5-10(3)7-8-11(4)9-12-6-2/h1,8,10,12H,6-7,9H2,2-4H3/b11-8- |
| InChIKey | RZTYROYXQWRUTA-FLIBITNWSA-N |
| XLogP | 2.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|