C15H13ClN2O — CID 103095082
8-chloro-3-(4-methoxyphenyl)-2-methylimidazo[1,2-a]pyridine (PubChem CID 103095082) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 8-chloro-3-(4-methoxyphenyl)-2-methylimidazo[1,2-a]pyridine.
| Compound Name | 8-chloro-3-(4-methoxyphenyl)-2-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 103095082 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 8-chloro-3-(4-methoxyphenyl)-2-methylimidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2c(C)nc3c(Cl)cccn23)cc1 |
| InChI | InChI=1S/C15H13ClN2O/c1-10-14(11-5-7-12(19-2)8-6-11)18-9-3-4-13(16)15(18)17-10/h3-9H,1-2H3 |
| InChIKey | WVRZMMRHXOGGFR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |