C16H16N2O — CID 115404302
3-(4-methoxyphenyl)-2,8-dimethylimidazo[1,2-a]pyridine (PubChem CID 115404302) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2,8-dimethylimidazo[1,2-a]pyridine.
| Compound Name | 3-(4-methoxyphenyl)-2,8-dimethylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 115404302 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-(4-methoxyphenyl)-2,8-dimethylimidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2c(C)nc3c(C)cccn23)cc1 |
| InChI | InChI=1S/C16H16N2O/c1-11-5-4-10-18-15(12(2)17-16(11)18)13-6-8-14(19-3)9-7-13/h4-10H,1-3H3 |
| InChIKey | PHYZEIJJYJKCFG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |