C8H13ClN2OS — CID 103095693
3-(1-chloropropyl)-5-(2-methylsulfanylethyl)-1,2,4-oxadiazole (PubChem CID 103095693) has the molecular formula C8H13ClN2OS and a molecular weight of 220.72 g/mol. Its IUPAC name is 3-(1-chloropropyl)-5-(2-methylsulfanylethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloropropyl)-5-(2-methylsulfanylethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103095693 |
| Molecular Formula | C8H13ClN2OS |
| Molecular Weight | 220.72 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 3-(1-chloropropyl)-5-(2-methylsulfanylethyl)-1,2,4-oxadiazole |
| SMILES | CCC(Cl)c1noc(CCSC)n1 |
| InChI | InChI=1S/C8H13ClN2OS/c1-3-6(9)8-10-7(12-11-8)4-5-13-2/h6H,3-5H2,1-2H3 |
| InChIKey | XDMKLGNZALFUOO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.72 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|