C9H15N3O11P2 — CID 10309726
[2-imidazol-1-yl-1-(4-nitrooxybutanoyloxy)-1-phosphonoethyl]phosphonic acid (PubChem CID 10309726) has the molecular formula C9H15N3O11P2 and a molecular weight of 403.18 g/mol. Its IUPAC name is [2-imidazol-1-yl-1-(4-nitrooxybutanoyloxy)-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-imidazol-1-yl-1-(4-nitrooxybutanoyloxy)-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 10309726 |
| Molecular Formula | C9H15N3O11P2 |
| Molecular Weight | 403.18 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | [2-imidazol-1-yl-1-(4-nitrooxybutanoyloxy)-1-phosphonoethyl]phosphonic acid |
| SMILES | O=C(CCCO[N+](=O)[O-])OC(Cn1ccnc1)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H15N3O11P2/c13-8(2-1-5-22-12(14)15)23-9(24(16,17)18,25(19,20)21)6-11-4-3-10-7-11/h3-4,7H,1-2,5-6H2,(H2,16,17,18)(H2,19,20,21) |
| InChIKey | RFEGVKGAGDGZNF-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 211.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.18 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|