C9H10F2N2O2S — CID 103098073
1-cyclopropyl-N-(2,6-difluoro-3-pyridinyl)methanesulfonamide (PubChem CID 103098073) has the molecular formula C9H10F2N2O2S and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-cyclopropyl-N-(2,6-difluoro-3-pyridinyl)methanesulfonamide.
| Compound Name | 1-cyclopropyl-N-(2,6-difluoro-3-pyridinyl)methanesulfonamide |
|---|---|
| PubChem CID | 103098073 |
| Molecular Formula | C9H10F2N2O2S |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1-cyclopropyl-N-(2,6-difluoro-3-pyridinyl)methanesulfonamide |
| SMILES | O=S(=O)(CC1CC1)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C9H10F2N2O2S/c10-8-4-3-7(9(11)12-8)13-16(14,15)5-6-1-2-6/h3-4,6,13H,1-2,5H2 |
| InChIKey | SDFSBDMVSICMCZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|