About 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile
3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile (PubChem CID 103098732) has the molecular formula C9H7BrN6
and a molecular weight of 279.10 g/mol. Its IUPAC name is 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile |
| PubChem CID | 103098732 |
| Molecular Formula | C9H7BrN6 |
| Molecular Weight | 279.10 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1Cn1nc(N)nc1Br |
| InChI | InChI=1S/C9H7BrN6/c10-8-14-9(12)15-16(8)5-6-2-1-3-13-7(6)4-11/h1-3H,5H2,(H2,12,15) |
| InChIKey | LBJCIMFUYFVLNP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.10 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile?
The IUPAC name of 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile (CID 103098732) is 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile.
What is the SMILES notation for 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile?
The canonical SMILES for 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile is N#Cc1ncccc1Cn1nc(N)nc1Br.
What is the InChIKey of 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile?
The InChIKey is LBJCIMFUYFVLNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN6/c10-8-14-9(12)15-16(8)5-6-2-1-3-13-7(6)4-11/h1-3H,5H2,(H2,12,15).
What are the key properties of 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile?
3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile has a molecular weight of 279.10 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-amino-5-bromo-1,2,4-triazol-1-yl)methyl]pyridine-2-carbonitrile is sourced from PubChem (CID 103098732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).