C10H20N2O4 — CID 103102950
ethyl 4-[(2-amino-2-oxoethyl)-ethylamino]-3-hydroxybutanoate (PubChem CID 103102950) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is ethyl 4-[(2-amino-2-oxoethyl)-ethylamino]-3-hydroxybutanoate.
| Compound Name | ethyl 4-[(2-amino-2-oxoethyl)-ethylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 103102950 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | ethyl 4-[(2-amino-2-oxoethyl)-ethylamino]-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)CN(CC)CC(N)=O |
| InChI | InChI=1S/C10H20N2O4/c1-3-12(7-9(11)14)6-8(13)5-10(15)16-4-2/h8,13H,3-7H2,1-2H3,(H2,11,14) |
| InChIKey | JKTHVTPOPIHQES-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |