C10H19N3O4 — CID 62922969
ethyl 3-[bis(2-amino-2-oxoethyl)amino]-2-methylpropanoate (PubChem CID 62922969) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 3-[bis(2-amino-2-oxoethyl)amino]-2-methylpropanoate.
| Compound Name | ethyl 3-[bis(2-amino-2-oxoethyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 62922969 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | ethyl 3-[bis(2-amino-2-oxoethyl)amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)CN(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C10H19N3O4/c1-3-17-10(16)7(2)4-13(5-8(11)14)6-9(12)15/h7H,3-6H2,1-2H3,(H2,11,14)(H2,12,15) |
| InChIKey | XRXGZNHDUAKXEB-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |