C6H14N4O3 — CID 134250575
2-[(2-amino-2-hydroxyethyl)-(2-amino-2-oxoethyl)amino]acetamide (PubChem CID 134250575) has the molecular formula C6H14N4O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-[(2-amino-2-hydroxyethyl)-(2-amino-2-oxoethyl)amino]acetamide.
| Compound Name | 2-[(2-amino-2-hydroxyethyl)-(2-amino-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 134250575 |
| Molecular Formula | C6H14N4O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-[(2-amino-2-hydroxyethyl)-(2-amino-2-oxoethyl)amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)CC(N)O |
| InChI | InChI=1S/C6H14N4O3/c7-4(11)1-10(2-5(8)12)3-6(9)13/h4,11H,1-3,7H2,(H2,8,12)(H2,9,13) |
| InChIKey | FCMOYBDZNHOQRE-UHFFFAOYSA-N |
| XLogP | -3.46 |
| TPSA | 135.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|