C15H31NO5 — CID 174478924
5-ethoxy-3-hydroxy-5-oxopentanoic acid;N-ethyl-N-propan-2-ylpropan-2-amine (PubChem CID 174478924) has the molecular formula C15H31NO5 and a molecular weight of 305.42 g/mol. Its IUPAC name is 5-ethoxy-3-hydroxy-5-oxopentanoic acid;N-ethyl-N-propan-2-ylpropan-2-amine.
| Compound Name | 5-ethoxy-3-hydroxy-5-oxopentanoic acid;N-ethyl-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 174478924 |
| Molecular Formula | C15H31NO5 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 5-ethoxy-3-hydroxy-5-oxopentanoic acid;N-ethyl-N-propan-2-ylpropan-2-amine |
| SMILES | CCN(C(C)C)C(C)C.CCOC(=O)CC(O)CC(=O)O |
| InChI | InChI=1S/C8H19N.C7H12O5/c1-6-9(7(2)3)8(4)5;1-2-12-7(11)4-5(8)3-6(9)10/h7-8H,6H2,1-5H3;5,8H,2-4H2,1H3,(H,9,10) |
| InChIKey | SMPPJRSGNFGROA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |